C22H21NO6 — CID 102146258
dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate (PubChem CID 102146258) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate.
| Compound Name | dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102146258 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)cn1C(=O)OC |
| InChI | InChI=1S/C22H21NO6/c1-26-16-9-5-14(6-10-16)18-13-23(22(25)29-4)20(21(24)28-3)19(18)15-7-11-17(27-2)12-8-15/h5-13H,1-4H3 |
| InChIKey | JHFUJPJIVOFOFE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |