dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate

C22H21NO6 — CID 102146258

IUPACdimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate
SMILESCOC(=O)c1c(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)cn1C(=O)OC
InChIInChI=1S/C22H21NO6/c1-26-16-9-5-14(6-10-16)18-13-23(22(25)29-4)20(21(24)28-3)19(18)15-7-11-17(27-2)12-8-15/h5-13H,1-4H3
InChIKeyJHFUJPJIVOFOFE-UHFFFAOYSA-N
MW395.41 g/mol
LogP4.24
Rot. Bonds5

About dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate

dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate (PubChem CID 102146258) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate.

Molecular Properties

Compound Namedimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate
PubChem CID102146258
Molecular FormulaC22H21NO6
Molecular Weight395.41 g/mol
Exact Mass395.14
IUPAC Namedimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate
SMILESCOC(=O)c1c(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)cn1C(=O)OC
InChIInChI=1S/C22H21NO6/c1-26-16-9-5-14(6-10-16)18-13-23(22(25)29-4)20(21(24)28-3)19(18)15-7-11-17(27-2)12-8-15/h5-13H,1-4H3
InChIKeyJHFUJPJIVOFOFE-UHFFFAOYSA-N
XLogP4.24
TPSA75.99 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500395.41
LogP ≤ 54.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate?
The IUPAC name of dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate (CID 102146258) is dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate?
The canonical SMILES for dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate is COC(=O)c1c(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)cn1C(=O)OC.
What is the InChIKey of dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate?
The InChIKey is JHFUJPJIVOFOFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO6/c1-26-16-9-5-14(6-10-16)18-13-23(22(25)29-4)20(21(24)28-3)19(18)15-7-11-17(27-2)12-8-15/h5-13H,1-4H3.
What are the key properties of dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate?
dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate has a molecular weight of 395.41 g/mol, XLogP of 4.24, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3,4-bis(4-methoxyphenyl)pyrrole-1,2-dicarboxylate is sourced from PubChem (CID 102146258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).