C13H20O3 — CID 102146970
(1R,2R,4S,5R)-7-(hydroxymethyl)-1,2-dimethyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 102146970) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (1R,2R,4S,5R)-7-(hydroxymethyl)-1,2-dimethyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2R,4S,5R)-7-(hydroxymethyl)-1,2-dimethyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 102146970 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (1R,2R,4S,5R)-7-(hydroxymethyl)-1,2-dimethyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC(C)[C@@H]1C(=O)[C@H](C)[C@@]2(C)O[C@@H]1C=C2CO |
| InChI | InChI=1S/C13H20O3/c1-7(2)11-10-5-9(6-14)13(4,16-10)8(3)12(11)15/h5,7-8,10-11,14H,6H2,1-4H3/t8-,10+,11-,13+/m0/s1 |
| InChIKey | GFEKXYMUQKSKJH-UIMWLRQOSA-N |
| XLogP | 1.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|