C26H30N2O3 — CID 102147441
N-tert-butyl-2-[4-[2-(tert-butylcarbamoyl)phenyl]-2-oxobut-3-ynyl]benzamide (PubChem CID 102147441) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[2-(tert-butylcarbamoyl)phenyl]-2-oxobut-3-ynyl]benzamide.
| Compound Name | N-tert-butyl-2-[4-[2-(tert-butylcarbamoyl)phenyl]-2-oxobut-3-ynyl]benzamide |
|---|---|
| PubChem CID | 102147441 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | N-tert-butyl-2-[4-[2-(tert-butylcarbamoyl)phenyl]-2-oxobut-3-ynyl]benzamide |
| SMILES | CC(C)(C)NC(=O)c1ccccc1C#CC(=O)Cc1ccccc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C26H30N2O3/c1-25(2,3)27-23(30)21-13-9-7-11-18(21)15-16-20(29)17-19-12-8-10-14-22(19)24(31)28-26(4,5)6/h7-14H,17H2,1-6H3,(H,27,30)(H,28,31) |
| InChIKey | KMNRBJDRAVPRLR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|