C31H29NO — CID 175507530
N-tert-butyl-2-[2-(2,2-diphenylethenyl)phenyl]benzamide (PubChem CID 175507530) has the molecular formula C31H29NO and a molecular weight of 431.58 g/mol. Its IUPAC name is N-tert-butyl-2-[2-(2,2-diphenylethenyl)phenyl]benzamide.
| Compound Name | N-tert-butyl-2-[2-(2,2-diphenylethenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 175507530 |
| Molecular Formula | C31H29NO |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-tert-butyl-2-[2-(2,2-diphenylethenyl)phenyl]benzamide |
| SMILES | CC(C)(C)NC(=O)c1ccccc1-c1ccccc1C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29NO/c1-31(2,3)32-30(33)28-21-13-12-20-27(28)26-19-11-10-18-25(26)22-29(23-14-6-4-7-15-23)24-16-8-5-9-17-24/h4-22H,1-3H3,(H,32,33) |
| InChIKey | MZMXYNITMVOCNS-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|