C17H21NO2 — CID 102148328
phenyl-[(1S,3R,6R)-spiro[7-oxabicyclo[4.1.0]heptane-3,3'-piperidine]-1'-yl]methanone (PubChem CID 102148328) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is phenyl-[(1S,3R,6R)-spiro[7-oxabicyclo[4.1.0]heptane-3,3'-piperidine]-1'-yl]methanone.
| Compound Name | phenyl-[(1S,3R,6R)-spiro[7-oxabicyclo[4.1.0]heptane-3,3'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 102148328 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | phenyl-[(1S,3R,6R)-spiro[7-oxabicyclo[4.1.0]heptane-3,3'-piperidine]-1'-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCC[C@]2(CC[C@H]3O[C@H]3C2)C1 |
| InChI | InChI=1S/C17H21NO2/c19-16(13-5-2-1-3-6-13)18-10-4-8-17(12-18)9-7-14-15(11-17)20-14/h1-3,5-6,14-15H,4,7-12H2/t14-,15+,17-/m1/s1 |
| InChIKey | CQEQYBSVJRKKTB-HLLBOEOZSA-N |
| XLogP | 2.86 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|