C23H24N2O2 — CID 121496958
2-[4-(9-oxa-2-azaspiro[5.5]undecane-2-carbonyl)phenyl]benzonitrile (PubChem CID 121496958) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[4-(9-oxa-2-azaspiro[5.5]undecane-2-carbonyl)phenyl]benzonitrile.
| Compound Name | 2-[4-(9-oxa-2-azaspiro[5.5]undecane-2-carbonyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 121496958 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[4-(9-oxa-2-azaspiro[5.5]undecane-2-carbonyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc(C(=O)N2CCCC3(CCOCC3)C2)cc1 |
| InChI | InChI=1S/C23H24N2O2/c24-16-20-4-1-2-5-21(20)18-6-8-19(9-7-18)22(26)25-13-3-10-23(17-25)11-14-27-15-12-23/h1-2,4-9H,3,10-15,17H2 |
| InChIKey | ZATAUUMFLUAVJJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |