C25H20FNO3 — CID 121142434
1'-[4-(4-fluorophenyl)benzoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 121142434) has the molecular formula C25H20FNO3 and a molecular weight of 401.44 g/mol. Its IUPAC name is 1'-[4-(4-fluorophenyl)benzoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one.
| Compound Name | 1'-[4-(4-fluorophenyl)benzoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one |
|---|---|
| PubChem CID | 121142434 |
| Molecular Formula | C25H20FNO3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1'-[4-(4-fluorophenyl)benzoyl]spiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | O=C1OC2(CCCN(C(=O)c3ccc(-c4ccc(F)cc4)cc3)C2)c2ccccc21 |
| InChI | InChI=1S/C25H20FNO3/c26-20-12-10-18(11-13-20)17-6-8-19(9-7-17)23(28)27-15-3-14-25(16-27)22-5-2-1-4-21(22)24(29)30-25/h1-2,4-13H,3,14-16H2 |
| InChIKey | QMOGZFKXAZMLQQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |