C17H19NO3 — CID 121142469
1'-(3-methylbut-2-enoyl)spiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 121142469) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 1'-(3-methylbut-2-enoyl)spiro[2-benzofuran-3,3'-piperidine]-1-one.
| Compound Name | 1'-(3-methylbut-2-enoyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
|---|---|
| PubChem CID | 121142469 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1'-(3-methylbut-2-enoyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | CC(C)=CC(=O)N1CCCC2(C1)OC(=O)c1ccccc12 |
| InChI | InChI=1S/C17H19NO3/c1-12(2)10-15(19)18-9-5-8-17(11-18)14-7-4-3-6-13(14)16(20)21-17/h3-4,6-7,10H,5,8-9,11H2,1-2H3 |
| InChIKey | KTSUTJMGSAJLBP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|