C19H16INO3 — CID 90618707
1'-(3-iodobenzoyl)spiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 90618707) has the molecular formula C19H16INO3 and a molecular weight of 433.25 g/mol. Its IUPAC name is 1'-(3-iodobenzoyl)spiro[2-benzofuran-3,3'-piperidine]-1-one.
| Compound Name | 1'-(3-iodobenzoyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
|---|---|
| PubChem CID | 90618707 |
| Molecular Formula | C19H16INO3 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 1'-(3-iodobenzoyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | O=C1OC2(CCCN(C(=O)c3cccc(I)c3)C2)c2ccccc21 |
| InChI | InChI=1S/C19H16INO3/c20-14-6-3-5-13(11-14)17(22)21-10-4-9-19(12-21)16-8-2-1-7-15(16)18(23)24-19/h1-3,5-8,11H,4,9-10,12H2 |
| InChIKey | WBEHKXNMQWRGMD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|