C21H18N2O3 — CID 90618618
1'-(1H-indole-6-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 90618618) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1'-(1H-indole-6-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one.
| Compound Name | 1'-(1H-indole-6-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
|---|---|
| PubChem CID | 90618618 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1'-(1H-indole-6-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | O=C1OC2(CCCN(C(=O)c3ccc4cc[nH]c4c3)C2)c2ccccc21 |
| InChI | InChI=1S/C21H18N2O3/c24-19(15-7-6-14-8-10-22-18(14)12-15)23-11-3-9-21(13-23)17-5-2-1-4-16(17)20(25)26-21/h1-2,4-8,10,12,22H,3,9,11,13H2 |
| InChIKey | MRPWKXMEOPJEFE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |