C22H17NO5 — CID 90618507
1'-(2-oxochromene-3-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 90618507) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is 1'-(2-oxochromene-3-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one.
| Compound Name | 1'-(2-oxochromene-3-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
|---|---|
| PubChem CID | 90618507 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 1'-(2-oxochromene-3-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | O=C1OC2(CCCN(C(=O)c3cc4ccccc4oc3=O)C2)c2ccccc21 |
| InChI | InChI=1S/C22H17NO5/c24-19(16-12-14-6-1-4-9-18(14)27-20(16)25)23-11-5-10-22(13-23)17-8-3-2-7-15(17)21(26)28-22/h1-4,6-9,12H,5,10-11,13H2 |
| InChIKey | VHYIILMWUVYKSN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|