C18H16N2O3 — CID 90618442
1'-(pyridine-3-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 90618442) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1'-(pyridine-3-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one.
| Compound Name | 1'-(pyridine-3-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
|---|---|
| PubChem CID | 90618442 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1'-(pyridine-3-carbonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | O=C1OC2(CCCN(C(=O)c3cccnc3)C2)c2ccccc21 |
| InChI | InChI=1S/C18H16N2O3/c21-16(13-5-3-9-19-11-13)20-10-4-8-18(12-20)15-7-2-1-6-14(15)17(22)23-18/h1-3,5-7,9,11H,4,8,10,12H2 |
| InChIKey | PPHPVVQICFKXEB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |