C22H17N3O4 — CID 72996845
1'-(4-pyrazin-2-yloxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one (PubChem CID 72996845) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 1'-(4-pyrazin-2-yloxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one.
| Compound Name | 1'-(4-pyrazin-2-yloxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one |
|---|---|
| PubChem CID | 72996845 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1'-(4-pyrazin-2-yloxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one |
| SMILES | O=C1OC2(CCN(C(=O)c3ccc(Oc4cnccn4)cc3)C2)c2ccccc21 |
| InChI | InChI=1S/C22H17N3O4/c26-20(15-5-7-16(8-6-15)28-19-13-23-10-11-24-19)25-12-9-22(14-25)18-4-2-1-3-17(18)21(27)29-22/h1-8,10-11,13H,9,12,14H2 |
| InChIKey | RYWQKGKUMDLOAW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |