C26H23NO4 — CID 72719184
1'-[4-(3-methoxyphenyl)benzoyl]spiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 72719184) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1'-[4-(3-methoxyphenyl)benzoyl]spiro[2-benzofuran-3,4'-piperidine]-1-one.
| Compound Name | 1'-[4-(3-methoxyphenyl)benzoyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 72719184 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1'-[4-(3-methoxyphenyl)benzoyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | COc1cccc(-c2ccc(C(=O)N3CCC4(CC3)OC(=O)c3ccccc34)cc2)c1 |
| InChI | InChI=1S/C26H23NO4/c1-30-21-6-4-5-20(17-21)18-9-11-19(12-10-18)24(28)27-15-13-26(14-16-27)23-8-3-2-7-22(23)25(29)31-26/h2-12,17H,13-16H2,1H3 |
| InChIKey | PNSLWNRLXIIQKL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |