C22H23NO5 — CID 90618202
1'-[4-(2-methoxyethoxy)benzoyl]spiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 90618202) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1'-[4-(2-methoxyethoxy)benzoyl]spiro[2-benzofuran-3,4'-piperidine]-1-one.
| Compound Name | 1'-[4-(2-methoxyethoxy)benzoyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 90618202 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1'-[4-(2-methoxyethoxy)benzoyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | COCCOc1ccc(C(=O)N2CCC3(CC2)OC(=O)c2ccccc23)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-26-14-15-27-17-8-6-16(7-9-17)20(24)23-12-10-22(11-13-23)19-5-3-2-4-18(19)21(25)28-22/h2-9H,10-15H2,1H3 |
| InChIKey | LRFNUWYLZRZTSY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|