C25H21NO4 — CID 121142406
1'-(4-phenoxybenzoyl)spiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 121142406) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 1'-(4-phenoxybenzoyl)spiro[2-benzofuran-3,4'-piperidine]-1-one.
| Compound Name | 1'-(4-phenoxybenzoyl)spiro[2-benzofuran-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 121142406 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1'-(4-phenoxybenzoyl)spiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | O=C1OC2(CCN(C(=O)c3ccc(Oc4ccccc4)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H21NO4/c27-23(18-10-12-20(13-11-18)29-19-6-2-1-3-7-19)26-16-14-25(15-17-26)22-9-5-4-8-21(22)24(28)30-25/h1-13H,14-17H2 |
| InChIKey | AAZJRFRHYFQDBK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |