C23H20N2O4 — CID 171906991
1-methyl-1'-(2-oxochromene-3-carbonyl)spiro[indole-3,3'-piperidine]-2-one (PubChem CID 171906991) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-methyl-1'-(2-oxochromene-3-carbonyl)spiro[indole-3,3'-piperidine]-2-one.
| Compound Name | 1-methyl-1'-(2-oxochromene-3-carbonyl)spiro[indole-3,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 171906991 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-methyl-1'-(2-oxochromene-3-carbonyl)spiro[indole-3,3'-piperidine]-2-one |
| SMILES | CN1C(=O)C2(CCCN(C(=O)c3cc4ccccc4oc3=O)C2)c2ccccc21 |
| InChI | InChI=1S/C23H20N2O4/c1-24-18-9-4-3-8-17(18)23(22(24)28)11-6-12-25(14-23)20(26)16-13-15-7-2-5-10-19(15)29-21(16)27/h2-5,7-10,13H,6,11-12,14H2,1H3 |
| InChIKey | YVISUMRPYABKPD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|