C21H23N3O3 — CID 126436971
(3S)-1-methyl-1'-(4,5,6,7-tetrahydro-2,1-benzoxazole-3-carbonyl)spiro[indole-3,3'-piperidine]-2-one (PubChem CID 126436971) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (3S)-1-methyl-1'-(4,5,6,7-tetrahydro-2,1-benzoxazole-3-carbonyl)spiro[indole-3,3'-piperidine]-2-one.
| Compound Name | (3S)-1-methyl-1'-(4,5,6,7-tetrahydro-2,1-benzoxazole-3-carbonyl)spiro[indole-3,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 126436971 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (3S)-1-methyl-1'-(4,5,6,7-tetrahydro-2,1-benzoxazole-3-carbonyl)spiro[indole-3,3'-piperidine]-2-one |
| SMILES | CN1C(=O)[C@@]2(CCCN(C(=O)c3onc4c3CCCC4)C2)c2ccccc21 |
| InChI | InChI=1S/C21H23N3O3/c1-23-17-10-5-3-8-15(17)21(20(23)26)11-6-12-24(13-21)19(25)18-14-7-2-4-9-16(14)22-27-18/h3,5,8,10H,2,4,6-7,9,11-13H2,1H3/t21-/m1/s1 |
| InChIKey | WXRSXSOFQONJBT-OAQYLSRUSA-N |
| XLogP | 2.70 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |