C22H26N2O2S — CID 97448869
1-[2-(4-thiophen-2-ylbenzoyl)-2,9-diazaspiro[5.5]undecan-9-yl]ethanone (PubChem CID 97448869) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-[2-(4-thiophen-2-ylbenzoyl)-2,9-diazaspiro[5.5]undecan-9-yl]ethanone.
| Compound Name | 1-[2-(4-thiophen-2-ylbenzoyl)-2,9-diazaspiro[5.5]undecan-9-yl]ethanone |
|---|---|
| PubChem CID | 97448869 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[2-(4-thiophen-2-ylbenzoyl)-2,9-diazaspiro[5.5]undecan-9-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CCCN(C(=O)c3ccc(-c4cccs4)cc3)C2)CC1 |
| InChI | InChI=1S/C22H26N2O2S/c1-17(25)23-13-10-22(11-14-23)9-3-12-24(16-22)21(26)19-7-5-18(6-8-19)20-4-2-15-27-20/h2,4-8,15H,3,9-14,16H2,1H3 |
| InChIKey | VQQSUVFQBUKVKM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |