C23H28N2OS — CID 118666638
[8-(azetidin-1-yl)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-phenylmethanone (PubChem CID 118666638) has the molecular formula C23H28N2OS and a molecular weight of 380.56 g/mol. Its IUPAC name is [8-(azetidin-1-yl)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-phenylmethanone.
| Compound Name | [8-(azetidin-1-yl)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 118666638 |
| Molecular Formula | C23H28N2OS |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [8-(azetidin-1-yl)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC2(CCC(c3cccs3)(N3CCC3)CC2)C1 |
| InChI | InChI=1S/C23H28N2OS/c26-21(19-6-2-1-3-7-19)24-16-13-22(18-24)9-11-23(12-10-22,25-14-5-15-25)20-8-4-17-27-20/h1-4,6-8,17H,5,9-16,18H2 |
| InChIKey | CVUXZUXULDTDLF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |