C23H30N2OS — CID 118666639
[8-(dimethylamino)-8-(5-methylthiophen-2-yl)-2-azaspiro[4.5]decan-2-yl]-phenylmethanone (PubChem CID 118666639) has the molecular formula C23H30N2OS and a molecular weight of 382.57 g/mol. Its IUPAC name is [8-(dimethylamino)-8-(5-methylthiophen-2-yl)-2-azaspiro[4.5]decan-2-yl]-phenylmethanone.
| Compound Name | [8-(dimethylamino)-8-(5-methylthiophen-2-yl)-2-azaspiro[4.5]decan-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 118666639 |
| Molecular Formula | C23H30N2OS |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [8-(dimethylamino)-8-(5-methylthiophen-2-yl)-2-azaspiro[4.5]decan-2-yl]-phenylmethanone |
| SMILES | Cc1ccc(C2(N(C)C)CCC3(CCN(C(=O)c4ccccc4)C3)CC2)s1 |
| InChI | InChI=1S/C23H30N2OS/c1-18-9-10-20(27-18)23(24(2)3)13-11-22(12-14-23)15-16-25(17-22)21(26)19-7-5-4-6-8-19/h4-10H,11-17H2,1-3H3 |
| InChIKey | LFQAMLNZDJGXCP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |