C15H17ClN4O2S — CID 102149063
(2S,3S)-2-amino-3-[3-(2-chlorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]butanoic acid (PubChem CID 102149063) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-[3-(2-chlorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]butanoic acid.
| Compound Name | (2S,3S)-2-amino-3-[3-(2-chlorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 102149063 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (2S,3S)-2-amino-3-[3-(2-chlorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]butanoic acid |
| SMILES | C=CCn1c(-c2ccccc2Cl)nn([C@@H](C)[C@H](N)C(=O)O)c1=S |
| InChI | InChI=1S/C15H17ClN4O2S/c1-3-8-19-13(10-6-4-5-7-11(10)16)18-20(15(19)23)9(2)12(17)14(21)22/h3-7,9,12H,1,8,17H2,2H3,(H,21,22)/t9-,12-/m0/s1 |
| InChIKey | KKFXXSLXGWVCJO-CABZTGNLSA-N |
| XLogP | 2.89 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|