C13H12ClNO2 — CID 83969443
7-chloro-3-methyl-1-prop-2-enylindole-2-carboxylic acid (PubChem CID 83969443) has the molecular formula C13H12ClNO2 and a molecular weight of 249.70 g/mol. Its IUPAC name is 7-chloro-3-methyl-1-prop-2-enylindole-2-carboxylic acid.
| Compound Name | 7-chloro-3-methyl-1-prop-2-enylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 83969443 |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 7-chloro-3-methyl-1-prop-2-enylindole-2-carboxylic acid |
| SMILES | C=CCn1c(C(=O)O)c(C)c2cccc(Cl)c21 |
| InChI | InChI=1S/C13H12ClNO2/c1-3-7-15-11(13(16)17)8(2)9-5-4-6-10(14)12(9)15/h3-6H,1,7H2,2H3,(H,16,17) |
| InChIKey | ZYJXNIYDAIRLDJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|