C24H19ClN2OS — CID 43944230
N-(4-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,2-diphenylacetamide (PubChem CID 43944230) has the molecular formula C24H19ClN2OS and a molecular weight of 418.95 g/mol. Its IUPAC name is N-(4-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,2-diphenylacetamide.
| Compound Name | N-(4-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 43944230 |
| Molecular Formula | C24H19ClN2OS |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-(4-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,2-diphenylacetamide |
| SMILES | C=CCn1/c(=N/C(=O)C(c2ccccc2)c2ccccc2)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C24H19ClN2OS/c1-2-16-27-22-19(25)14-9-15-20(22)29-24(27)26-23(28)21(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h2-15,21H,1,16H2/b26-24- |
| InChIKey | NOXRAKKVTWMWEY-LCUIJRPUSA-N |
| XLogP | 5.80 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|