C24H18N2OS — CID 3550580
2,2-diphenyl-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 3550580) has the molecular formula C24H18N2OS and a molecular weight of 382.49 g/mol. Its IUPAC name is 2,2-diphenyl-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2,2-diphenyl-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 3550580 |
| Molecular Formula | C24H18N2OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2,2-diphenyl-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C#CCn1/c(=N/C(=O)C(c2ccccc2)c2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C24H18N2OS/c1-2-17-26-20-15-9-10-16-21(20)28-24(26)25-23(27)22(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h1,3-16,22H,17H2/b25-24- |
| InChIKey | QMSNRFBYXOTOPH-IZHYLOQSSA-N |
| XLogP | 4.60 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|