5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid

C15H17NO4 — CID 83969493

IUPAC5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid
SMILESC=CCn1c(C(=O)O)c(C)c2cc(OC)cc(OC)c21
InChIInChI=1S/C15H17NO4/c1-5-6-16-13(15(17)18)9(2)11-7-10(19-3)8-12(20-4)14(11)16/h5,7-8H,1,6H2,2-4H3,(H,17,18)
InChIKeyKDOCOXQFTIYZJB-UHFFFAOYSA-N
MW275.30 g/mol
LogP2.85
Rot. Bonds5

About 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid

5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid (PubChem CID 83969493) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid.

Molecular Properties

Compound Name5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid
PubChem CID83969493
Molecular FormulaC15H17NO4
Molecular Weight275.30 g/mol
Exact Mass275.12
IUPAC Name5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid
SMILESC=CCn1c(C(=O)O)c(C)c2cc(OC)cc(OC)c21
InChIInChI=1S/C15H17NO4/c1-5-6-16-13(15(17)18)9(2)11-7-10(19-3)8-12(20-4)14(11)16/h5,7-8H,1,6H2,2-4H3,(H,17,18)
InChIKeyKDOCOXQFTIYZJB-UHFFFAOYSA-N
XLogP2.85
TPSA60.69 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.30
LogP ≤ 52.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid?
The IUPAC name of 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid (CID 83969493) is 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid.
What is the SMILES notation for 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid?
The canonical SMILES for 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid is C=CCn1c(C(=O)O)c(C)c2cc(OC)cc(OC)c21.
What is the InChIKey of 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid?
The InChIKey is KDOCOXQFTIYZJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO4/c1-5-6-16-13(15(17)18)9(2)11-7-10(19-3)8-12(20-4)14(11)16/h5,7-8H,1,6H2,2-4H3,(H,17,18).
What are the key properties of 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid?
5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid has a molecular weight of 275.30 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethoxy-3-methyl-1-prop-2-enylindole-2-carboxylic acid is sourced from PubChem (CID 83969493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).