methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate

C14H17NO4 — CID 15395202

IUPACmethyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate
SMILESCOC(=O)c1c(C)c2cc(OC)cc(OC)c2n1C
InChIInChI=1S/C14H17NO4/c1-8-10-6-9(17-3)7-11(18-4)13(10)15(2)12(8)14(16)19-5/h6-7H,1-5H3
InChIKeyQXLJSBCHVXEQQE-UHFFFAOYSA-N
MW263.29 g/mol
LogP2.29
Rot. Bonds3

About methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate

methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate (PubChem CID 15395202) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate.

Molecular Properties

Compound Namemethyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate
PubChem CID15395202
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Namemethyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate
SMILESCOC(=O)c1c(C)c2cc(OC)cc(OC)c2n1C
InChIInChI=1S/C14H17NO4/c1-8-10-6-9(17-3)7-11(18-4)13(10)15(2)12(8)14(16)19-5/h6-7H,1-5H3
InChIKeyQXLJSBCHVXEQQE-UHFFFAOYSA-N
XLogP2.29
TPSA49.69 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 52.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}

Analyze methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate?
The IUPAC name of methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate (CID 15395202) is methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate.
What is the SMILES notation for methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate?
The canonical SMILES for methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate is COC(=O)c1c(C)c2cc(OC)cc(OC)c2n1C.
What is the InChIKey of methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate?
The InChIKey is QXLJSBCHVXEQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-8-10-6-9(17-3)7-11(18-4)13(10)15(2)12(8)14(16)19-5/h6-7H,1-5H3.
What are the key properties of methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate?
methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate has a molecular weight of 263.29 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate is sourced from PubChem (CID 15395202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).