C14H17NO4 — CID 15395202
methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate (PubChem CID 15395202) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate.
| Compound Name | methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate |
|---|---|
| PubChem CID | 15395202 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 5,7-dimethoxy-1,3-dimethylindole-2-carboxylate |
| SMILES | COC(=O)c1c(C)c2cc(OC)cc(OC)c2n1C |
| InChI | InChI=1S/C14H17NO4/c1-8-10-6-9(17-3)7-11(18-4)13(10)15(2)12(8)14(16)19-5/h6-7H,1-5H3 |
| InChIKey | QXLJSBCHVXEQQE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|