C19H20Cl2N2O — CID 11674962
7-[(2-chlorophenoxy)methyl]-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride (PubChem CID 11674962) has the molecular formula C19H20Cl2N2O and a molecular weight of 363.29 g/mol. Its IUPAC name is 7-[(2-chlorophenoxy)methyl]-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride.
| Compound Name | 7-[(2-chlorophenoxy)methyl]-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 11674962 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 7-[(2-chlorophenoxy)methyl]-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride |
| SMILES | C=CCn1c(C)c(C)c2ccnc(COc3ccccc3Cl)c21.Cl |
| InChI | InChI=1S/C19H19ClN2O.ClH/c1-4-11-22-14(3)13(2)15-9-10-21-17(19(15)22)12-23-18-8-6-5-7-16(18)20;/h4-10H,1,11-12H2,2-3H3;1H |
| InChIKey | AOZLLTDIPIWUIN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|