C15H22O6 — CID 102150894
(3R,3aR,6R,6aR,9R,9aS,9bR)-3-hydroxy-3,9-bis(hydroxymethyl)spiro[4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-2-one (PubChem CID 102150894) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (3R,3aR,6R,6aR,9R,9aS,9bR)-3-hydroxy-3,9-bis(hydroxymethyl)spiro[4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-2-one.
| Compound Name | (3R,3aR,6R,6aR,9R,9aS,9bR)-3-hydroxy-3,9-bis(hydroxymethyl)spiro[4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 102150894 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (3R,3aR,6R,6aR,9R,9aS,9bR)-3-hydroxy-3,9-bis(hydroxymethyl)spiro[4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-2-one |
| SMILES | O=C1O[C@@H]2[C@H]3[C@H](CO)CC[C@H]3[C@]3(CC[C@H]2[C@@]1(O)CO)CO3 |
| InChI | InChI=1S/C15H22O6/c16-5-8-1-2-9-11(8)12-10(3-4-14(9)7-20-14)15(19,6-17)13(18)21-12/h8-12,16-17,19H,1-7H2/t8-,9+,10+,11-,12-,14-,15-/m0/s1 |
| InChIKey | WDTAONOOISZVFX-SNVGUIIKSA-N |
| XLogP | -0.55 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|