C11H14O5 — CID 134270794
2-[3-[(3R)-6-oxo-1-oxaspiro[2.5]octan-4-yl]oxiran-2-yl]acetic acid (PubChem CID 134270794) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-[3-[(3R)-6-oxo-1-oxaspiro[2.5]octan-4-yl]oxiran-2-yl]acetic acid.
| Compound Name | 2-[3-[(3R)-6-oxo-1-oxaspiro[2.5]octan-4-yl]oxiran-2-yl]acetic acid |
|---|---|
| PubChem CID | 134270794 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-[3-[(3R)-6-oxo-1-oxaspiro[2.5]octan-4-yl]oxiran-2-yl]acetic acid |
| SMILES | O=C(O)CC1OC1C1CC(=O)CC[C@]12CO2 |
| InChI | InChI=1S/C11H14O5/c12-6-1-2-11(5-15-11)7(3-6)10-8(16-10)4-9(13)14/h7-8,10H,1-5H2,(H,13,14)/t7?,8?,10?,11-/m0/s1 |
| InChIKey | OSFPPQNUNBZXTJ-BYTLDJTHSA-N |
| XLogP | 0.37 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|