C16H24O3 — CID 10400596
(3aR,8aR,9aR)-5-(hydroxymethyl)-8a-methylspiro[4,4a,5,6,7,8,9,9a-octahydro-3aH-benzo[f][1]benzofuran-3,1'-cyclopropane]-2-one (PubChem CID 10400596) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (3aR,8aR,9aR)-5-(hydroxymethyl)-8a-methylspiro[4,4a,5,6,7,8,9,9a-octahydro-3aH-benzo[f][1]benzofuran-3,1'-cyclopropane]-2-one.
| Compound Name | (3aR,8aR,9aR)-5-(hydroxymethyl)-8a-methylspiro[4,4a,5,6,7,8,9,9a-octahydro-3aH-benzo[f][1]benzofuran-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 10400596 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3aR,8aR,9aR)-5-(hydroxymethyl)-8a-methylspiro[4,4a,5,6,7,8,9,9a-octahydro-3aH-benzo[f][1]benzofuran-3,1'-cyclopropane]-2-one |
| SMILES | C[C@]12CCCC(CO)C1C[C@H]1[C@@H](C2)OC(=O)C12CC2 |
| InChI | InChI=1S/C16H24O3/c1-15-4-2-3-10(9-17)11(15)7-12-13(8-15)19-14(18)16(12)5-6-16/h10-13,17H,2-9H2,1H3/t10?,11?,12-,13+,15+/m0/s1 |
| InChIKey | LPYKGESYHGEELR-BETDDWGKSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |