C19H17NO7 — CID 102150976
3-[(3aS,4S,7S,7aR)-2-[4-(carboxymethyl)phenyl]-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-5-yl]propanoic acid (PubChem CID 102150976) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is 3-[(3aS,4S,7S,7aR)-2-[4-(carboxymethyl)phenyl]-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-5-yl]propanoic acid.
| Compound Name | 3-[(3aS,4S,7S,7aR)-2-[4-(carboxymethyl)phenyl]-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 102150976 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 3-[(3aS,4S,7S,7aR)-2-[4-(carboxymethyl)phenyl]-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-5-yl]propanoic acid |
| SMILES | O=C(O)CCC1=C[C@@H]2O[C@H]1[C@H]1C(=O)N(c3ccc(CC(=O)O)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C19H17NO7/c21-13(22)6-3-10-8-12-15-16(17(10)27-12)19(26)20(18(15)25)11-4-1-9(2-5-11)7-14(23)24/h1-2,4-5,8,12,15-17H,3,6-7H2,(H,21,22)(H,23,24)/t12-,15-,16-,17+/m0/s1 |
| InChIKey | GKVIMSLRTNHIMM-OSMBCOQSSA-N |
| XLogP | 0.99 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|