C14H24N8O4 — CID 102152021
(2S)-2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 102152021) has the molecular formula C14H24N8O4 and a molecular weight of 368.40 g/mol. Its IUPAC name is (2S)-2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 102152021 |
| Molecular Formula | C14H24N8O4 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (2S)-2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCN(C(=O)Cn1ccc(N)nc1=O)[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C14H24N8O4/c15-4-7-22(9(12(24)25)2-1-5-19-13(17)18)11(23)8-21-6-3-10(16)20-14(21)26/h3,6,9H,1-2,4-5,7-8,15H2,(H,24,25)(H2,16,20,26)(H4,17,18,19)/t9-/m0/s1 |
| InChIKey | OIOLRWKJRNMEPG-VIFPVBQESA-N |
| XLogP | -2.88 |
| TPSA | 208.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|