C13H21N5O4 — CID 139059715
(2S)-6-amino-2-[3-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]hexanoic acid (PubChem CID 139059715) has the molecular formula C13H21N5O4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2S)-6-amino-2-[3-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[3-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 139059715 |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2S)-6-amino-2-[3-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CCn1ccc(N)nc1=O)C(=O)O |
| InChI | InChI=1S/C13H21N5O4/c14-6-2-1-3-9(12(20)21)16-11(19)5-8-18-7-4-10(15)17-13(18)22/h4,7,9H,1-3,5-6,8,14H2,(H,16,19)(H,20,21)(H2,15,17,22)/t9-/m0/s1 |
| InChIKey | JOKIMZRBMBRGNW-VIFPVBQESA-N |
| XLogP | -1.09 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|