C12H16N4O6 — CID 101202246
(2S)-2-[3-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]pentanedioic acid (PubChem CID 101202246) has the molecular formula C12H16N4O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is (2S)-2-[3-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[3-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 101202246 |
| Molecular Formula | C12H16N4O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2S)-2-[3-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]pentanedioic acid |
| SMILES | Nc1ccn(CCC(=O)N[C@@H](CCC(=O)O)C(=O)O)c(=O)n1 |
| InChI | InChI=1S/C12H16N4O6/c13-8-3-5-16(12(22)15-8)6-4-9(17)14-7(11(20)21)1-2-10(18)19/h3,5,7H,1-2,4,6H2,(H,14,17)(H,18,19)(H,20,21)(H2,13,15,22)/t7-/m0/s1 |
| InChIKey | SDDBROGCYKDRBS-ZETCQYMHSA-N |
| XLogP | -1.35 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |