C35H54O5 — CID 102153015
(1R)-6-(4-butylphenoxy)-1-[(2S,5R)-5-[(1R)-5-(4-butylphenoxy)-1-hydroxypentyl]oxolan-2-yl]hexan-1-ol (PubChem CID 102153015) has the molecular formula C35H54O5 and a molecular weight of 554.81 g/mol. Its IUPAC name is (1R)-6-(4-butylphenoxy)-1-[(2S,5R)-5-[(1R)-5-(4-butylphenoxy)-1-hydroxypentyl]oxolan-2-yl]hexan-1-ol.
| Compound Name | (1R)-6-(4-butylphenoxy)-1-[(2S,5R)-5-[(1R)-5-(4-butylphenoxy)-1-hydroxypentyl]oxolan-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 102153015 |
| Molecular Formula | C35H54O5 |
| Molecular Weight | 554.81 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | (1R)-6-(4-butylphenoxy)-1-[(2S,5R)-5-[(1R)-5-(4-butylphenoxy)-1-hydroxypentyl]oxolan-2-yl]hexan-1-ol |
| SMILES | CCCCc1ccc(OCCCCC[C@@H](O)[C@@H]2CC[C@H]([C@H](O)CCCCOc3ccc(CCCC)cc3)O2)cc1 |
| InChI | InChI=1S/C35H54O5/c1-3-5-12-28-16-20-30(21-17-28)38-26-10-7-8-14-32(36)34-24-25-35(40-34)33(37)15-9-11-27-39-31-22-18-29(19-23-31)13-6-4-2/h16-23,32-37H,3-15,24-27H2,1-2H3/t32-,33-,34+,35-/m1/s1 |
| InChIKey | PDIXJFQUGTYVOC-NDLNHBFLSA-N |
| XLogP | 7.83 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.81 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|