C21H31B — CID 102153434
9-[(E,1R)-1-phenylhept-2-enyl]-9-borabicyclo[3.3.1]nonane (PubChem CID 102153434) has the molecular formula C21H31B and a molecular weight of 294.29 g/mol. Its IUPAC name is 9-[(E,1R)-1-phenylhept-2-enyl]-9-borabicyclo[3.3.1]nonane.
| Compound Name | 9-[(E,1R)-1-phenylhept-2-enyl]-9-borabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 102153434 |
| Molecular Formula | C21H31B |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 9-[(E,1R)-1-phenylhept-2-enyl]-9-borabicyclo[3.3.1]nonane |
| SMILES | CCCC/C=C/[C@@H](B1C2CCCC1CCC2)c1ccccc1 |
| InChI | InChI=1S/C21H31B/c1-2-3-4-8-17-21(18-11-6-5-7-12-18)22-19-13-9-14-20(22)16-10-15-19/h5-8,11-12,17,19-21H,2-4,9-10,13-16H2,1H3/b17-8+/t19?,20?,21-/m1/s1 |
| InChIKey | NKTUWARULWKOCA-RYJJBMCRSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|