C13H13N5O2 — CID 102154310
5-ethoxy-6-methyl-3-phenyltriazolo[4,5-d]pyrimidin-7-one (PubChem CID 102154310) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 5-ethoxy-6-methyl-3-phenyltriazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-ethoxy-6-methyl-3-phenyltriazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 102154310 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 5-ethoxy-6-methyl-3-phenyltriazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCOc1nc2c(nnn2-c2ccccc2)c(=O)n1C |
| InChI | InChI=1S/C13H13N5O2/c1-3-20-13-14-11-10(12(19)17(13)2)15-16-18(11)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3 |
| InChIKey | ZYJAUAXLLQNUBA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |