C11H8ClN5 — CID 23258932
5-chloro-7-methyl-3-phenyltriazolo[4,5-d]pyrimidine (PubChem CID 23258932) has the molecular formula C11H8ClN5 and a molecular weight of 245.67 g/mol. Its IUPAC name is 5-chloro-7-methyl-3-phenyltriazolo[4,5-d]pyrimidine.
| Compound Name | 5-chloro-7-methyl-3-phenyltriazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 23258932 |
| Molecular Formula | C11H8ClN5 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 5-chloro-7-methyl-3-phenyltriazolo[4,5-d]pyrimidine |
| SMILES | Cc1nc(Cl)nc2c1nnn2-c1ccccc1 |
| InChI | InChI=1S/C11H8ClN5/c1-7-9-10(14-11(12)13-7)17(16-15-9)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | LMCBUXLNFVVGAY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |