C17H17N7O3 — CID 13381785
N',N'-diacetyl-N-(7-methyl-5-phenylpyrazolo[5,4-e][1,2,4]triazin-3-yl)acetohydrazide (PubChem CID 13381785) has the molecular formula C17H17N7O3 and a molecular weight of 367.37 g/mol. Its IUPAC name is N',N'-diacetyl-N-(7-methyl-5-phenylpyrazolo[5,4-e][1,2,4]triazin-3-yl)acetohydrazide.
| Compound Name | N',N'-diacetyl-N-(7-methyl-5-phenylpyrazolo[5,4-e][1,2,4]triazin-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 13381785 |
| Molecular Formula | C17H17N7O3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N',N'-diacetyl-N-(7-methyl-5-phenylpyrazolo[5,4-e][1,2,4]triazin-3-yl)acetohydrazide |
| SMILES | CC(=O)N(C(C)=O)N(C(C)=O)c1nnc2c(C)nn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C17H17N7O3/c1-10-15-16(22(21-10)14-8-6-5-7-9-14)18-17(20-19-15)24(13(4)27)23(11(2)25)12(3)26/h5-9H,1-4H3 |
| InChIKey | DYOVNHYYUCDNFJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 114.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|