C23H32O9 — CID 102154467
methyl 2-[(1R,3S,5R,9S,12R,14S,16R,18S,22S)-14,16-dimethyl-7,19-dioxo-4,8,13,17,23-pentaoxapentacyclo[12.9.0.03,12.05,9.016,22]tricosan-18-yl]acetate (PubChem CID 102154467) has the molecular formula C23H32O9 and a molecular weight of 452.50 g/mol. Its IUPAC name is methyl 2-[(1R,3S,5R,9S,12R,14S,16R,18S,22S)-14,16-dimethyl-7,19-dioxo-4,8,13,17,23-pentaoxapentacyclo[12.9.0.03,12.05,9.016,22]tricosan-18-yl]acetate.
| Compound Name | methyl 2-[(1R,3S,5R,9S,12R,14S,16R,18S,22S)-14,16-dimethyl-7,19-dioxo-4,8,13,17,23-pentaoxapentacyclo[12.9.0.03,12.05,9.016,22]tricosan-18-yl]acetate |
|---|---|
| PubChem CID | 102154467 |
| Molecular Formula | C23H32O9 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | methyl 2-[(1R,3S,5R,9S,12R,14S,16R,18S,22S)-14,16-dimethyl-7,19-dioxo-4,8,13,17,23-pentaoxapentacyclo[12.9.0.03,12.05,9.016,22]tricosan-18-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@]2(C)C[C@]3(C)O[C@@H]4CC[C@@H]5OC(=O)C[C@H]5O[C@H]4C[C@H]3O[C@H]2CCC1=O |
| InChI | InChI=1S/C23H32O9/c1-22-11-23(2)19(30-18(22)7-4-12(24)15(32-22)9-20(25)27-3)8-16-14(31-23)6-5-13-17(28-16)10-21(26)29-13/h13-19H,4-11H2,1-3H3/t13-,14+,15-,16-,17+,18-,19+,22+,23-/m0/s1 |
| InChIKey | DDYFMDWPONEHJT-VVURTRNFSA-N |
| XLogP | 1.62 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |