C18H28O5 — CID 101411303
(1R,3R,4R,6R,9R,11S,13R)-1-methyl-13-pentyl-2,5,8,12-tetraoxatetracyclo[9.5.0.03,9.04,6]hexadecan-7-one (PubChem CID 101411303) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1R,3R,4R,6R,9R,11S,13R)-1-methyl-13-pentyl-2,5,8,12-tetraoxatetracyclo[9.5.0.03,9.04,6]hexadecan-7-one.
| Compound Name | (1R,3R,4R,6R,9R,11S,13R)-1-methyl-13-pentyl-2,5,8,12-tetraoxatetracyclo[9.5.0.03,9.04,6]hexadecan-7-one |
|---|---|
| PubChem CID | 101411303 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (1R,3R,4R,6R,9R,11S,13R)-1-methyl-13-pentyl-2,5,8,12-tetraoxatetracyclo[9.5.0.03,9.04,6]hexadecan-7-one |
| SMILES | CCCCC[C@@H]1CCC[C@@]2(C)O[C@H]3[C@H]4O[C@H]4C(=O)O[C@@H]3C[C@@H]2O1 |
| InChI | InChI=1S/C18H28O5/c1-3-4-5-7-11-8-6-9-18(2)13(20-11)10-12-14(23-18)15-16(22-15)17(19)21-12/h11-16H,3-10H2,1-2H3/t11-,12-,13+,14-,15-,16-,18-/m1/s1 |
| InChIKey | WKZBMNJBZFCVCZ-GZIOAMKESA-N |
| XLogP | 2.74 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|