C22H30O9 — CID 101401604
2-[(1R,3S,5R,9S,12R,14S,16R,18S,22S)-14,16-dimethyl-7,19-dioxo-4,8,13,17,23-pentaoxapentacyclo[12.9.0.03,12.05,9.016,22]tricosan-18-yl]acetic acid (PubChem CID 101401604) has the molecular formula C22H30O9 and a molecular weight of 438.47 g/mol. Its IUPAC name is 2-[(1R,3S,5R,9S,12R,14S,16R,18S,22S)-14,16-dimethyl-7,19-dioxo-4,8,13,17,23-pentaoxapentacyclo[12.9.0.03,12.05,9.016,22]tricosan-18-yl]acetic acid.
| Compound Name | 2-[(1R,3S,5R,9S,12R,14S,16R,18S,22S)-14,16-dimethyl-7,19-dioxo-4,8,13,17,23-pentaoxapentacyclo[12.9.0.03,12.05,9.016,22]tricosan-18-yl]acetic acid |
|---|---|
| PubChem CID | 101401604 |
| Molecular Formula | C22H30O9 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[(1R,3S,5R,9S,12R,14S,16R,18S,22S)-14,16-dimethyl-7,19-dioxo-4,8,13,17,23-pentaoxapentacyclo[12.9.0.03,12.05,9.016,22]tricosan-18-yl]acetic acid |
| SMILES | C[C@@]12C[C@]3(C)O[C@@H]4CC[C@@H]5OC(=O)C[C@H]5O[C@H]4C[C@H]3O[C@H]1CCC(=O)[C@H](CC(=O)O)O2 |
| InChI | InChI=1S/C22H30O9/c1-21-10-22(2)18(29-17(21)6-3-11(23)14(31-21)8-19(24)25)7-15-13(30-22)5-4-12-16(27-15)9-20(26)28-12/h12-18H,3-10H2,1-2H3,(H,24,25)/t12-,13+,14-,15-,16+,17-,18+,21+,22-/m0/s1 |
| InChIKey | OTXLUJLUXJDTPF-OBHWTVNZSA-N |
| XLogP | 1.54 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |