C13H22O7P2 — CID 10215479
3,3-bis(dimethoxyphosphoryl)propoxybenzene (PubChem CID 10215479) has the molecular formula C13H22O7P2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 3,3-bis(dimethoxyphosphoryl)propoxybenzene.
| Compound Name | 3,3-bis(dimethoxyphosphoryl)propoxybenzene |
|---|---|
| PubChem CID | 10215479 |
| Molecular Formula | C13H22O7P2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3,3-bis(dimethoxyphosphoryl)propoxybenzene |
| SMILES | COP(=O)(OC)C(CCOc1ccccc1)P(=O)(OC)OC |
| InChI | InChI=1S/C13H22O7P2/c1-16-21(14,17-2)13(22(15,18-3)19-4)10-11-20-12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3 |
| InChIKey | CRGQUXMDFWUZDE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|