C12H18N2O4 — CID 102155814
tert-butyl N-[(3aR,4S,7aS)-2-oxo-3a,4,7,7a-tetrahydro-3H-1,3-benzoxazol-4-yl]carbamate (PubChem CID 102155814) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is tert-butyl N-[(3aR,4S,7aS)-2-oxo-3a,4,7,7a-tetrahydro-3H-1,3-benzoxazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3aR,4S,7aS)-2-oxo-3a,4,7,7a-tetrahydro-3H-1,3-benzoxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 102155814 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | tert-butyl N-[(3aR,4S,7aS)-2-oxo-3a,4,7,7a-tetrahydro-3H-1,3-benzoxazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C=CC[C@@H]2OC(=O)N[C@H]12 |
| InChI | InChI=1S/C12H18N2O4/c1-12(2,3)18-11(16)13-7-5-4-6-8-9(7)14-10(15)17-8/h4-5,7-9H,6H2,1-3H3,(H,13,16)(H,14,15)/t7-,8-,9+/m0/s1 |
| InChIKey | NQVWYQISAVKWDQ-XHNCKOQMSA-N |
| XLogP | 1.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|