C28H42N2O6 — CID 161168545
tert-butyl N-[(3aS,4R,7aS)-2,3,3a,4,7,7a-hexahydro-1H-inden-4-yl]carbamate;tert-butyl N-[(3aS,4R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroinden-4-yl]carbamate (PubChem CID 161168545) has the molecular formula C28H42N2O6 and a molecular weight of 502.65 g/mol. Its IUPAC name is tert-butyl N-[(3aS,4R,7aS)-2,3,3a,4,7,7a-hexahydro-1H-inden-4-yl]carbamate;tert-butyl N-[(3aS,4R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroinden-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3aS,4R,7aS)-2,3,3a,4,7,7a-hexahydro-1H-inden-4-yl]carbamate;tert-butyl N-[(3aS,4R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroinden-4-yl]carbamate |
|---|---|
| PubChem CID | 161168545 |
| Molecular Formula | C28H42N2O6 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | tert-butyl N-[(3aS,4R,7aS)-2,3,3a,4,7,7a-hexahydro-1H-inden-4-yl]carbamate;tert-butyl N-[(3aS,4R,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroinden-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C=CC[C@@H]2C(=O)CC(=O)[C@@H]21.CC(C)(C)OC(=O)N[C@@H]1C=CC[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C14H19NO4.C14H23NO2/c1-14(2,3)19-13(18)15-9-6-4-5-8-10(16)7-11(17)12(8)9;1-14(2,3)17-13(16)15-12-9-5-7-10-6-4-8-11(10)12/h4,6,8-9,12H,5,7H2,1-3H3,(H,15,18);5,9-12H,4,6-8H2,1-3H3,(H,15,16)/t8-,9-,12+;10-,11-,12+/m10/s1 |
| InChIKey | UQWLGIFHYXAREK-YSOMAKJMSA-N |
| XLogP | 4.87 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|