C22H35NO3 — CID 10215614
4-[(4-decanoyl-3-methylphenyl)methylamino]butanoic acid (PubChem CID 10215614) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 4-[(4-decanoyl-3-methylphenyl)methylamino]butanoic acid.
| Compound Name | 4-[(4-decanoyl-3-methylphenyl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 10215614 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 4-[(4-decanoyl-3-methylphenyl)methylamino]butanoic acid |
| SMILES | CCCCCCCCCC(=O)c1ccc(CNCCCC(=O)O)cc1C |
| InChI | InChI=1S/C22H35NO3/c1-3-4-5-6-7-8-9-11-21(24)20-14-13-19(16-18(20)2)17-23-15-10-12-22(25)26/h13-14,16,23H,3-12,15,17H2,1-2H3,(H,25,26) |
| InChIKey | IVNYAIMBPCFNBM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|