C14H23F2NO4 — CID 102156797
tert-butyl N-[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-enyl]carbamate (PubChem CID 102156797) has the molecular formula C14H23F2NO4 and a molecular weight of 307.34 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-enyl]carbamate |
|---|---|
| PubChem CID | 102156797 |
| Molecular Formula | C14H23F2NO4 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | tert-butyl N-[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-enyl]carbamate |
| SMILES | C=CC(F)(F)[C@H](NC(=O)OC(C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H23F2NO4/c1-7-14(15,16)10(9-8-19-13(5,6)20-9)17-11(18)21-12(2,3)4/h7,9-10H,1,8H2,2-6H3,(H,17,18)/t9-,10+/m0/s1 |
| InChIKey | UDJPTOHFZZXHEY-VHSXEESVSA-N |
| XLogP | 2.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|