C14H25NO4 — CID 52916322
tert-butyl N-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]carbamate (PubChem CID 52916322) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 52916322 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl N-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]carbamate |
| SMILES | C=CC[C@@H](NC(=O)OC(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H25NO4/c1-7-8-10(11-9-17-14(5,6)18-11)15-12(16)19-13(2,3)4/h7,10-11H,1,8-9H2,2-6H3,(H,15,16)/t10-,11-/m1/s1 |
| InChIKey | MLYICKGWEUNNET-GHMZBOCLSA-N |
| XLogP | 2.61 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|