C21H33BrN2O4Si — CID 102156899
tert-butyl (2E)-2-(acetylhydrazinylidene)-3-(2-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypropanoate (PubChem CID 102156899) has the molecular formula C21H33BrN2O4Si and a molecular weight of 485.50 g/mol. Its IUPAC name is tert-butyl (2E)-2-(acetylhydrazinylidene)-3-(2-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypropanoate.
| Compound Name | tert-butyl (2E)-2-(acetylhydrazinylidene)-3-(2-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypropanoate |
|---|---|
| PubChem CID | 102156899 |
| Molecular Formula | C21H33BrN2O4Si |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | tert-butyl (2E)-2-(acetylhydrazinylidene)-3-(2-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypropanoate |
| SMILES | CC(=O)N/N=C(/C(=O)OC(C)(C)C)C(O[Si](C)(C)C(C)(C)C)c1ccccc1Br |
| InChI | InChI=1S/C21H33BrN2O4Si/c1-14(25)23-24-17(19(26)27-20(2,3)4)18(15-12-10-11-13-16(15)22)28-29(8,9)21(5,6)7/h10-13,18H,1-9H3,(H,23,25)/b24-17+ |
| InChIKey | CHSANUVZVGSUNX-JJIBRWJFSA-N |
| XLogP | 5.35 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|